raaeraae22
raaeraae22
04-02-2017
Chemistry
contestada
When is di- used in the name of a hydrocarbon?
Respuesta :
DoctorCass
DoctorCass
04-02-2017
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer Link
VER TODAS LAS RESPUESTAS ( 27+ )
Otras preguntas
Which system is considered the body’s pleasure center?
Rick bought 5 yogurt bars at the snack shop. Each yogurt bar cost $1.75 . Complete the table please!
The company, hewerrtt, would like to make letter codes using all of the letters in the word hewerrtt. how many codes can be made from all the letters in this wo
Why do bare feet feel colder on a tile floor than on a rug? Carpet prevents cold from reaching your feet. Tile conducts the heat away from your feet. Ti
A ________ shows the capacity required at each work center based on planned and released orders for each time period of the plan.
all the countries of central america and the caribbean continue to rely on agriculture as a primary source of income and would be considered: A developed nation
Which statement about memoirs is most true? A. They use narrative elements to recount personal experience and development. B. They use narrative elements to tel
Which verb best completes the sentence? Este mes _______ intereses por mantener mi dinero guardado en el banco. pagué gané gasté ahorré
How much atp is produced from a single glucose molecule in each reaction set?
why is it colder in siberia in winter than at the north pole?
