churchillvanessam churchillvanessam

03-10-2020
Chemistry

contestada

For NH4NO3(s) write a balanced thermochemical equation.

Respuesta :

sagarsaud666 sagarsaud666

03-10-2020

Answer:

step1

NH4NO3(s)+H2O(I)--------->NH⁴OH(aq)+HNO³(aq)

step²

NH⁴OH(aq)+HNO³(aq)-------->NH⁴+(aq)+NO³-(aq)+H²O(I)

Answer Link

Otras preguntas

Which of the following can you see if you visit Santiago de Cuba? A. The National Capital Building B. La Gran Piedra C. El Paseo del Prado D. The Fortaleza de S

what are the parts of a chemical reaction

what is the voice in a text

are the smallest biological structural units of the body

what are the three main features of a eukaryotic cell?

How does a longshore current change a beach

Serena is the manager of the coffee shop. Jordan an employee earns $16.50 per hour. The amount of money Serena earns is represented by the equation m = 21 h,

What cell organelle is responsible for breaking down sugar to produce energy? mitochondria golgi complex nucleus ribosome

molly wonders if she should cheat on the test to pass the class or if she should risk failing because she knows she hasn’t really learned the material. which is

For a parallel structure of identical components, the system can succeed if at least one of the components succeeds. Assume that components fail independently